C12H17NO2 — CID 43201672
N-(2-methylbutyl)-1,3-benzodioxol-5-amine (PubChem CID 43201672) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is N-(2-methylbutyl)-1,3-benzodioxol-5-amine.
| Compound Name | N-(2-methylbutyl)-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 43201672 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | N-(2-methylbutyl)-1,3-benzodioxol-5-amine |
| SMILES | CCC(C)CNc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H17NO2/c1-3-9(2)7-13-10-4-5-11-12(6-10)15-8-14-11/h4-6,9,13H,3,7-8H2,1-2H3 |
| InChIKey | NKURNCLAWDCGQM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|