C15H19N3O2 — CID 64801213
N-[(1-butan-2-ylpyrazol-3-yl)methyl]-1,3-benzodioxol-5-amine (PubChem CID 64801213) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is N-[(1-butan-2-ylpyrazol-3-yl)methyl]-1,3-benzodioxol-5-amine.
| Compound Name | N-[(1-butan-2-ylpyrazol-3-yl)methyl]-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 64801213 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | N-[(1-butan-2-ylpyrazol-3-yl)methyl]-1,3-benzodioxol-5-amine |
| SMILES | CCC(C)n1ccc(CNc2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C15H19N3O2/c1-3-11(2)18-7-6-13(17-18)9-16-12-4-5-14-15(8-12)20-10-19-14/h4-8,11,16H,3,9-10H2,1-2H3 |
| InChIKey | SJLMPIUNQHKKAK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|