C13H15N3O4 — CID 114757008
2-[1-[[(6-nitro-1,3-benzoxazol-2-yl)amino]methyl]cyclopropyl]ethanol (PubChem CID 114757008) has the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. Its IUPAC name is 2-[1-[[(6-nitro-1,3-benzoxazol-2-yl)amino]methyl]cyclopropyl]ethanol.
| Compound Name | 2-[1-[[(6-nitro-1,3-benzoxazol-2-yl)amino]methyl]cyclopropyl]ethanol |
|---|---|
| PubChem CID | 114757008 |
| Molecular Formula | C13H15N3O4 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 2-[1-[[(6-nitro-1,3-benzoxazol-2-yl)amino]methyl]cyclopropyl]ethanol |
| SMILES | O=[N+]([O-])c1ccc2nc(NCC3(CCO)CC3)oc2c1 |
| InChI | InChI=1S/C13H15N3O4/c17-6-5-13(3-4-13)8-14-12-15-10-2-1-9(16(18)19)7-11(10)20-12/h1-2,7,17H,3-6,8H2,(H,14,15) |
| InChIKey | UQXBPXXJYYQJRW-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 101.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|