C10H12N4O3S — CID 103647935
2-(3-methyl-1,2,4-oxadiazol-5-yl)-N-[(5-nitrothiophen-3-yl)methyl]ethanamine (PubChem CID 103647935) has the molecular formula C10H12N4O3S and a molecular weight of 268.30 g/mol. Its IUPAC name is 2-(3-methyl-1,2,4-oxadiazol-5-yl)-N-[(5-nitrothiophen-3-yl)methyl]ethanamine.
| Compound Name | 2-(3-methyl-1,2,4-oxadiazol-5-yl)-N-[(5-nitrothiophen-3-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 103647935 |
| Molecular Formula | C10H12N4O3S |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 2-(3-methyl-1,2,4-oxadiazol-5-yl)-N-[(5-nitrothiophen-3-yl)methyl]ethanamine |
| SMILES | Cc1noc(CCNCc2csc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C10H12N4O3S/c1-7-12-9(17-13-7)2-3-11-5-8-4-10(14(15)16)18-6-8/h4,6,11H,2-3,5H2,1H3 |
| InChIKey | FXWPFYPFVUEYIV-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|