C15H21Cl3N2 — CID 102751760
3,5,6-trichloro-N-(3,3,5,5-tetramethylcyclohexyl)pyridin-2-amine (PubChem CID 102751760) has the molecular formula C15H21Cl3N2 and a molecular weight of 335.71 g/mol. Its IUPAC name is 3,5,6-trichloro-N-(3,3,5,5-tetramethylcyclohexyl)pyridin-2-amine.
| Compound Name | 3,5,6-trichloro-N-(3,3,5,5-tetramethylcyclohexyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102751760 |
| Molecular Formula | C15H21Cl3N2 |
| Molecular Weight | 335.71 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 3,5,6-trichloro-N-(3,3,5,5-tetramethylcyclohexyl)pyridin-2-amine |
| SMILES | CC1(C)CC(Nc2nc(Cl)c(Cl)cc2Cl)CC(C)(C)C1 |
| InChI | InChI=1S/C15H21Cl3N2/c1-14(2)6-9(7-15(3,4)8-14)19-13-11(17)5-10(16)12(18)20-13/h5,9H,6-8H2,1-4H3,(H,19,20) |
| InChIKey | SDOFKNPVRMYMHI-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.71 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|