C12H15Cl3N2O — CID 106364152
[2-[(3,5,6-trichloro-2-pyridinyl)amino]cyclohexyl]methanol (PubChem CID 106364152) has the molecular formula C12H15Cl3N2O and a molecular weight of 309.62 g/mol. Its IUPAC name is [2-[(3,5,6-trichloro-2-pyridinyl)amino]cyclohexyl]methanol.
| Compound Name | [2-[(3,5,6-trichloro-2-pyridinyl)amino]cyclohexyl]methanol |
|---|---|
| PubChem CID | 106364152 |
| Molecular Formula | C12H15Cl3N2O |
| Molecular Weight | 309.62 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | [2-[(3,5,6-trichloro-2-pyridinyl)amino]cyclohexyl]methanol |
| SMILES | OCC1CCCCC1Nc1nc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H15Cl3N2O/c13-8-5-9(14)12(17-11(8)15)16-10-4-2-1-3-7(10)6-18/h5,7,10,18H,1-4,6H2,(H,16,17) |
| InChIKey | FTIHYHHAFMXSLB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.62 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|