About [2-[(3,5,6-trifluoro-2-pyridinyl)amino]cyclohexyl]methanol
[2-[(3,5,6-trifluoro-2-pyridinyl)amino]cyclohexyl]methanol (PubChem CID 106364159) has the molecular formula C12H15F3N2O
and a molecular weight of 260.26 g/mol. Its IUPAC name is [2-[(3,5,6-trifluoro-2-pyridinyl)amino]cyclohexyl]methanol.
Molecular Properties
| Compound Name | [2-[(3,5,6-trifluoro-2-pyridinyl)amino]cyclohexyl]methanol |
| PubChem CID | 106364159 |
| Molecular Formula | C12H15F3N2O |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | [2-[(3,5,6-trifluoro-2-pyridinyl)amino]cyclohexyl]methanol |
| SMILES | OCC1CCCCC1Nc1nc(F)c(F)cc1F |
| InChI | InChI=1S/C12H15F3N2O/c13-8-5-9(14)12(17-11(8)15)16-10-4-2-1-3-7(10)6-18/h5,7,10,18H,1-4,6H2,(H,16,17) |
| InChIKey | DZAOJYSWQOZBJZ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze [2-[(3,5,6-trifluoro-2-pyridinyl)amino]cyclohexyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(3,5,6-trifluoro-2-pyridinyl)amino]cyclohexyl]methanol?
The IUPAC name of [2-[(3,5,6-trifluoro-2-pyridinyl)amino]cyclohexyl]methanol (CID 106364159) is [2-[(3,5,6-trifluoro-2-pyridinyl)amino]cyclohexyl]methanol.
What is the SMILES notation for [2-[(3,5,6-trifluoro-2-pyridinyl)amino]cyclohexyl]methanol?
The canonical SMILES for [2-[(3,5,6-trifluoro-2-pyridinyl)amino]cyclohexyl]methanol is OCC1CCCCC1Nc1nc(F)c(F)cc1F.
What is the InChIKey of [2-[(3,5,6-trifluoro-2-pyridinyl)amino]cyclohexyl]methanol?
The InChIKey is DZAOJYSWQOZBJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F3N2O/c13-8-5-9(14)12(17-11(8)15)16-10-4-2-1-3-7(10)6-18/h5,7,10,18H,1-4,6H2,(H,16,17).
What are the key properties of [2-[(3,5,6-trifluoro-2-pyridinyl)amino]cyclohexyl]methanol?
[2-[(3,5,6-trifluoro-2-pyridinyl)amino]cyclohexyl]methanol has a molecular weight of 260.26 g/mol, XLogP of 2.46, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(3,5,6-trifluoro-2-pyridinyl)amino]cyclohexyl]methanol is sourced from PubChem (CID 106364159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).