C13H18FIN2O — CID 114178420
[2-(2-amino-5-fluoro-4-iodoanilino)cyclohexyl]methanol (PubChem CID 114178420) has the molecular formula C13H18FIN2O and a molecular weight of 364.20 g/mol. Its IUPAC name is [2-(2-amino-5-fluoro-4-iodoanilino)cyclohexyl]methanol.
| Compound Name | [2-(2-amino-5-fluoro-4-iodoanilino)cyclohexyl]methanol |
|---|---|
| PubChem CID | 114178420 |
| Molecular Formula | C13H18FIN2O |
| Molecular Weight | 364.20 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | [2-(2-amino-5-fluoro-4-iodoanilino)cyclohexyl]methanol |
| SMILES | Nc1cc(I)c(F)cc1NC1CCCCC1CO |
| InChI | InChI=1S/C13H18FIN2O/c14-9-5-13(11(16)6-10(9)15)17-12-4-2-1-3-8(12)7-18/h5-6,8,12,17-18H,1-4,7,16H2 |
| InChIKey | WDMDBHYKWKVMBP-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.20 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|