C13H18FIN2 — CID 79861884
2-N-(2,2-dimethylcyclopentyl)-4-fluoro-5-iodobenzene-1,2-diamine (PubChem CID 79861884) has the molecular formula C13H18FIN2 and a molecular weight of 348.20 g/mol. Its IUPAC name is 2-N-(2,2-dimethylcyclopentyl)-4-fluoro-5-iodobenzene-1,2-diamine.
| Compound Name | 2-N-(2,2-dimethylcyclopentyl)-4-fluoro-5-iodobenzene-1,2-diamine |
|---|---|
| PubChem CID | 79861884 |
| Molecular Formula | C13H18FIN2 |
| Molecular Weight | 348.20 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | 2-N-(2,2-dimethylcyclopentyl)-4-fluoro-5-iodobenzene-1,2-diamine |
| SMILES | CC1(C)CCCC1Nc1cc(F)c(I)cc1N |
| InChI | InChI=1S/C13H18FIN2/c1-13(2)5-3-4-12(13)17-11-6-8(14)9(15)7-10(11)16/h6-7,12,17H,3-5,16H2,1-2H3 |
| InChIKey | LGEGTNLABPQEJI-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.20 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|