C12H15FN2O3 — CID 114178774
5-fluoro-2-[[2-(hydroxymethyl)cyclopentyl]amino]pyridine-3-carboxylic acid (PubChem CID 114178774) has the molecular formula C12H15FN2O3 and a molecular weight of 254.26 g/mol. Its IUPAC name is 5-fluoro-2-[[2-(hydroxymethyl)cyclopentyl]amino]pyridine-3-carboxylic acid.
| Compound Name | 5-fluoro-2-[[2-(hydroxymethyl)cyclopentyl]amino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 114178774 |
| Molecular Formula | C12H15FN2O3 |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 5-fluoro-2-[[2-(hydroxymethyl)cyclopentyl]amino]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cc(F)cnc1NC1CCCC1CO |
| InChI | InChI=1S/C12H15FN2O3/c13-8-4-9(12(17)18)11(14-5-8)15-10-3-1-2-7(10)6-16/h4-5,7,10,16H,1-3,6H2,(H,14,15)(H,17,18) |
| InChIKey | CEQCZVITYWGHOD-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |