C16H25ClN2O — CID 83028148
2-chloro-4-N-(2,2-diethyloxan-4-yl)-5-methylbenzene-1,4-diamine (PubChem CID 83028148) has the molecular formula C16H25ClN2O and a molecular weight of 296.84 g/mol. Its IUPAC name is 2-chloro-4-N-(2,2-diethyloxan-4-yl)-5-methylbenzene-1,4-diamine.
| Compound Name | 2-chloro-4-N-(2,2-diethyloxan-4-yl)-5-methylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 83028148 |
| Molecular Formula | C16H25ClN2O |
| Molecular Weight | 296.84 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 2-chloro-4-N-(2,2-diethyloxan-4-yl)-5-methylbenzene-1,4-diamine |
| SMILES | CCC1(CC)CC(Nc2cc(Cl)c(N)cc2C)CCO1 |
| InChI | InChI=1S/C16H25ClN2O/c1-4-16(5-2)10-12(6-7-20-16)19-15-9-13(17)14(18)8-11(15)3/h8-9,12,19H,4-7,10,18H2,1-3H3 |
| InChIKey | VXEOTIOBDLDNKM-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.84 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|