C16H23FN2OS — CID 83036685
2-[(2,2-diethyloxan-4-yl)amino]-6-fluorobenzenecarbothioamide (PubChem CID 83036685) has the molecular formula C16H23FN2OS and a molecular weight of 310.44 g/mol. Its IUPAC name is 2-[(2,2-diethyloxan-4-yl)amino]-6-fluorobenzenecarbothioamide.
| Compound Name | 2-[(2,2-diethyloxan-4-yl)amino]-6-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 83036685 |
| Molecular Formula | C16H23FN2OS |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 2-[(2,2-diethyloxan-4-yl)amino]-6-fluorobenzenecarbothioamide |
| SMILES | CCC1(CC)CC(Nc2cccc(F)c2C(N)=S)CCO1 |
| InChI | InChI=1S/C16H23FN2OS/c1-3-16(4-2)10-11(8-9-20-16)19-13-7-5-6-12(17)14(13)15(18)21/h5-7,11,19H,3-4,8-10H2,1-2H3,(H2,18,21) |
| InChIKey | YOSGDXVKKRWXRK-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|