C17H26FNO2 — CID 83036436
2-[(2,2-diethyloxan-4-yl)amino]-1-(2-fluorophenyl)ethanol (PubChem CID 83036436) has the molecular formula C17H26FNO2 and a molecular weight of 295.40 g/mol. Its IUPAC name is 2-[(2,2-diethyloxan-4-yl)amino]-1-(2-fluorophenyl)ethanol.
| Compound Name | 2-[(2,2-diethyloxan-4-yl)amino]-1-(2-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 83036436 |
| Molecular Formula | C17H26FNO2 |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 2-[(2,2-diethyloxan-4-yl)amino]-1-(2-fluorophenyl)ethanol |
| SMILES | CCC1(CC)CC(NCC(O)c2ccccc2F)CCO1 |
| InChI | InChI=1S/C17H26FNO2/c1-3-17(4-2)11-13(9-10-21-17)19-12-16(20)14-7-5-6-8-15(14)18/h5-8,13,16,19-20H,3-4,9-12H2,1-2H3 |
| InChIKey | VDZWDAQINCESET-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |