C17H25F2NO — CID 116789249
N-(2,2-difluoro-2-phenylethyl)-2,2-diethyloxan-4-amine (PubChem CID 116789249) has the molecular formula C17H25F2NO and a molecular weight of 297.39 g/mol. Its IUPAC name is N-(2,2-difluoro-2-phenylethyl)-2,2-diethyloxan-4-amine.
| Compound Name | N-(2,2-difluoro-2-phenylethyl)-2,2-diethyloxan-4-amine |
|---|---|
| PubChem CID | 116789249 |
| Molecular Formula | C17H25F2NO |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | N-(2,2-difluoro-2-phenylethyl)-2,2-diethyloxan-4-amine |
| SMILES | CCC1(CC)CC(NCC(F)(F)c2ccccc2)CCO1 |
| InChI | InChI=1S/C17H25F2NO/c1-3-16(4-2)12-15(10-11-21-16)20-13-17(18,19)14-8-6-5-7-9-14/h5-9,15,20H,3-4,10-13H2,1-2H3 |
| InChIKey | NTEYQSGKMPKMTF-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |