C16H22F3NO — CID 103868574
2,2-diethyl-N-[(2,4,5-trifluorophenyl)methyl]oxan-4-amine (PubChem CID 103868574) has the molecular formula C16H22F3NO and a molecular weight of 301.35 g/mol. Its IUPAC name is 2,2-diethyl-N-[(2,4,5-trifluorophenyl)methyl]oxan-4-amine.
| Compound Name | 2,2-diethyl-N-[(2,4,5-trifluorophenyl)methyl]oxan-4-amine |
|---|---|
| PubChem CID | 103868574 |
| Molecular Formula | C16H22F3NO |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 2,2-diethyl-N-[(2,4,5-trifluorophenyl)methyl]oxan-4-amine |
| SMILES | CCC1(CC)CC(NCc2cc(F)c(F)cc2F)CCO1 |
| InChI | InChI=1S/C16H22F3NO/c1-3-16(4-2)9-12(5-6-21-16)20-10-11-7-14(18)15(19)8-13(11)17/h7-8,12,20H,3-6,9-10H2,1-2H3 |
| InChIKey | MDFMQKJGCCVQSR-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|