C17H25F2NO — CID 83035815
N-[1-(3,4-difluorophenyl)ethyl]-2,2-diethyloxan-4-amine (PubChem CID 83035815) has the molecular formula C17H25F2NO and a molecular weight of 297.39 g/mol. Its IUPAC name is N-[1-(3,4-difluorophenyl)ethyl]-2,2-diethyloxan-4-amine.
| Compound Name | N-[1-(3,4-difluorophenyl)ethyl]-2,2-diethyloxan-4-amine |
|---|---|
| PubChem CID | 83035815 |
| Molecular Formula | C17H25F2NO |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | N-[1-(3,4-difluorophenyl)ethyl]-2,2-diethyloxan-4-amine |
| SMILES | CCC1(CC)CC(NC(C)c2ccc(F)c(F)c2)CCO1 |
| InChI | InChI=1S/C17H25F2NO/c1-4-17(5-2)11-14(8-9-21-17)20-12(3)13-6-7-15(18)16(19)10-13/h6-7,10,12,14,20H,4-5,8-9,11H2,1-3H3 |
| InChIKey | REPFBDFULJLAFB-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |