C14H24N2O4S — CID 83035865
5-[[(2,2-diethyloxan-4-yl)amino]methyl]furan-2-sulfonamide (PubChem CID 83035865) has the molecular formula C14H24N2O4S and a molecular weight of 316.42 g/mol. Its IUPAC name is 5-[[(2,2-diethyloxan-4-yl)amino]methyl]furan-2-sulfonamide.
| Compound Name | 5-[[(2,2-diethyloxan-4-yl)amino]methyl]furan-2-sulfonamide |
|---|---|
| PubChem CID | 83035865 |
| Molecular Formula | C14H24N2O4S |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 5-[[(2,2-diethyloxan-4-yl)amino]methyl]furan-2-sulfonamide |
| SMILES | CCC1(CC)CC(NCc2ccc(S(N)(=O)=O)o2)CCO1 |
| InChI | InChI=1S/C14H24N2O4S/c1-3-14(4-2)9-11(7-8-19-14)16-10-12-5-6-13(20-12)21(15,17)18/h5-6,11,16H,3-4,7-10H2,1-2H3,(H2,15,17,18) |
| InChIKey | HFJCJKLBNALPMG-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |