C16H23ClFNO — CID 102615898
N-[(2-chloro-5-fluorophenyl)methyl]-2,2-diethyloxan-4-amine (PubChem CID 102615898) has the molecular formula C16H23ClFNO and a molecular weight of 299.82 g/mol. Its IUPAC name is N-[(2-chloro-5-fluorophenyl)methyl]-2,2-diethyloxan-4-amine.
| Compound Name | N-[(2-chloro-5-fluorophenyl)methyl]-2,2-diethyloxan-4-amine |
|---|---|
| PubChem CID | 102615898 |
| Molecular Formula | C16H23ClFNO |
| Molecular Weight | 299.82 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | N-[(2-chloro-5-fluorophenyl)methyl]-2,2-diethyloxan-4-amine |
| SMILES | CCC1(CC)CC(NCc2cc(F)ccc2Cl)CCO1 |
| InChI | InChI=1S/C16H23ClFNO/c1-3-16(4-2)10-14(7-8-20-16)19-11-12-9-13(18)5-6-15(12)17/h5-6,9,14,19H,3-4,7-8,10-11H2,1-2H3 |
| InChIKey | PUWWVUADHIGWFO-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.82 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |