C17H26N2O2 — CID 103867854
1-benzyl-3-(2,2-diethyloxan-4-yl)urea (PubChem CID 103867854) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 1-benzyl-3-(2,2-diethyloxan-4-yl)urea.
| Compound Name | 1-benzyl-3-(2,2-diethyloxan-4-yl)urea |
|---|---|
| PubChem CID | 103867854 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 1-benzyl-3-(2,2-diethyloxan-4-yl)urea |
| SMILES | CCC1(CC)CC(NC(=O)NCc2ccccc2)CCO1 |
| InChI | InChI=1S/C17H26N2O2/c1-3-17(4-2)12-15(10-11-21-17)19-16(20)18-13-14-8-6-5-7-9-14/h5-9,15H,3-4,10-13H2,1-2H3,(H2,18,19,20) |
| InChIKey | WUCBRDHBBIKESM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |