C11H13BrN2S — CID 114891701
5-bromo-2-[(2-methylcyclopropyl)amino]benzenecarbothioamide (PubChem CID 114891701) has the molecular formula C11H13BrN2S and a molecular weight of 285.21 g/mol. Its IUPAC name is 5-bromo-2-[(2-methylcyclopropyl)amino]benzenecarbothioamide.
| Compound Name | 5-bromo-2-[(2-methylcyclopropyl)amino]benzenecarbothioamide |
|---|---|
| PubChem CID | 114891701 |
| Molecular Formula | C11H13BrN2S |
| Molecular Weight | 285.21 g/mol |
| Exact Mass | 284.00 |
| IUPAC Name | 5-bromo-2-[(2-methylcyclopropyl)amino]benzenecarbothioamide |
| SMILES | CC1CC1Nc1ccc(Br)cc1C(N)=S |
| InChI | InChI=1S/C11H13BrN2S/c1-6-4-10(6)14-9-3-2-7(12)5-8(9)11(13)15/h2-3,5-6,10,14H,4H2,1H3,(H2,13,15) |
| InChIKey | KIPPVGCJPQVHHR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.21 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|