C11H13BrN2OS2 — CID 82703515
N-(4-bromo-2-carbamothioylphenyl)-3-methylsulfanylpropanamide (PubChem CID 82703515) has the molecular formula C11H13BrN2OS2 and a molecular weight of 333.28 g/mol. Its IUPAC name is N-(4-bromo-2-carbamothioylphenyl)-3-methylsulfanylpropanamide.
| Compound Name | N-(4-bromo-2-carbamothioylphenyl)-3-methylsulfanylpropanamide |
|---|---|
| PubChem CID | 82703515 |
| Molecular Formula | C11H13BrN2OS2 |
| Molecular Weight | 333.28 g/mol |
| Exact Mass | 331.97 |
| IUPAC Name | N-(4-bromo-2-carbamothioylphenyl)-3-methylsulfanylpropanamide |
| SMILES | CSCCC(=O)Nc1ccc(Br)cc1C(N)=S |
| InChI | InChI=1S/C11H13BrN2OS2/c1-17-5-4-10(15)14-9-3-2-7(12)6-8(9)11(13)16/h2-3,6H,4-5H2,1H3,(H2,13,16)(H,14,15) |
| InChIKey | VGTOBJRHEDMIDM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|