C16H21BrN2OS — CID 107798584
N-(5-bromo-2-carbamothioylphenyl)-3-cyclohexylpropanamide (PubChem CID 107798584) has the molecular formula C16H21BrN2OS and a molecular weight of 369.33 g/mol. Its IUPAC name is N-(5-bromo-2-carbamothioylphenyl)-3-cyclohexylpropanamide.
| Compound Name | N-(5-bromo-2-carbamothioylphenyl)-3-cyclohexylpropanamide |
|---|---|
| PubChem CID | 107798584 |
| Molecular Formula | C16H21BrN2OS |
| Molecular Weight | 369.33 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | N-(5-bromo-2-carbamothioylphenyl)-3-cyclohexylpropanamide |
| SMILES | NC(=S)c1ccc(Br)cc1NC(=O)CCC1CCCCC1 |
| InChI | InChI=1S/C16H21BrN2OS/c17-12-7-8-13(16(18)21)14(10-12)19-15(20)9-6-11-4-2-1-3-5-11/h7-8,10-11H,1-6,9H2,(H2,18,21)(H,19,20) |
| InChIKey | WMRDFYPZEIYRRI-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.33 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|