C11H14BrN3O2S — CID 107800712
N-[5-bromo-2-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-3-methylsulfanylpropanamide (PubChem CID 107800712) has the molecular formula C11H14BrN3O2S and a molecular weight of 332.22 g/mol. Its IUPAC name is N-[5-bromo-2-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-3-methylsulfanylpropanamide.
| Compound Name | N-[5-bromo-2-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-3-methylsulfanylpropanamide |
|---|---|
| PubChem CID | 107800712 |
| Molecular Formula | C11H14BrN3O2S |
| Molecular Weight | 332.22 g/mol |
| Exact Mass | 331.00 |
| IUPAC Name | N-[5-bromo-2-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-3-methylsulfanylpropanamide |
| SMILES | CSCCC(=O)Nc1cc(Br)ccc1/C(N)=N/O |
| InChI | InChI=1S/C11H14BrN3O2S/c1-18-5-4-10(16)14-9-6-7(12)2-3-8(9)11(13)15-17/h2-3,6,17H,4-5H2,1H3,(H2,13,15)(H,14,16) |
| InChIKey | YTVURBYYELYPQS-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.22 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|