C11H15BrN4O2 — CID 107800929
3-[5-bromo-2-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-1-ethyl-1-methylurea (PubChem CID 107800929) has the molecular formula C11H15BrN4O2 and a molecular weight of 315.17 g/mol. Its IUPAC name is 3-[5-bromo-2-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-1-ethyl-1-methylurea.
| Compound Name | 3-[5-bromo-2-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-1-ethyl-1-methylurea |
|---|---|
| PubChem CID | 107800929 |
| Molecular Formula | C11H15BrN4O2 |
| Molecular Weight | 315.17 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 3-[5-bromo-2-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-1-ethyl-1-methylurea |
| SMILES | CCN(C)C(=O)Nc1cc(Br)ccc1/C(N)=N/O |
| InChI | InChI=1S/C11H15BrN4O2/c1-3-16(2)11(17)14-9-6-7(12)4-5-8(9)10(13)15-18/h4-6,18H,3H2,1-2H3,(H2,13,15)(H,14,17) |
| InChIKey | USJKMAMWZIQILA-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.17 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|