C11H14N2S — CID 62409950
2-[(2-methylcyclopropyl)amino]benzenecarbothioamide (PubChem CID 62409950) has the molecular formula C11H14N2S and a molecular weight of 206.31 g/mol. Its IUPAC name is 2-[(2-methylcyclopropyl)amino]benzenecarbothioamide.
| Compound Name | 2-[(2-methylcyclopropyl)amino]benzenecarbothioamide |
|---|---|
| PubChem CID | 62409950 |
| Molecular Formula | C11H14N2S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 2-[(2-methylcyclopropyl)amino]benzenecarbothioamide |
| SMILES | CC1CC1Nc1ccccc1C(N)=S |
| InChI | InChI=1S/C11H14N2S/c1-7-6-10(7)13-9-5-3-2-4-8(9)11(12)14/h2-5,7,10,13H,6H2,1H3,(H2,12,14) |
| InChIKey | ARRSGTBENRXIPG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|