C15H22N2S — CID 62307855
4-methyl-2-[(2-methylcyclohexyl)amino]benzenecarbothioamide (PubChem CID 62307855) has the molecular formula C15H22N2S and a molecular weight of 262.42 g/mol. Its IUPAC name is 4-methyl-2-[(2-methylcyclohexyl)amino]benzenecarbothioamide.
| Compound Name | 4-methyl-2-[(2-methylcyclohexyl)amino]benzenecarbothioamide |
|---|---|
| PubChem CID | 62307855 |
| Molecular Formula | C15H22N2S |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 4-methyl-2-[(2-methylcyclohexyl)amino]benzenecarbothioamide |
| SMILES | Cc1ccc(C(N)=S)c(NC2CCCCC2C)c1 |
| InChI | InChI=1S/C15H22N2S/c1-10-7-8-12(15(16)18)14(9-10)17-13-6-4-3-5-11(13)2/h7-9,11,13,17H,3-6H2,1-2H3,(H2,16,18) |
| InChIKey | VUQJPTUIUDJFAV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|