C9H12N2S — CID 62309052
4-methyl-2-(methylamino)benzenecarbothioamide (PubChem CID 62309052) has the molecular formula C9H12N2S and a molecular weight of 180.28 g/mol. Its IUPAC name is 4-methyl-2-(methylamino)benzenecarbothioamide.
| Compound Name | 4-methyl-2-(methylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 62309052 |
| Molecular Formula | C9H12N2S |
| Molecular Weight | 180.28 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | 4-methyl-2-(methylamino)benzenecarbothioamide |
| SMILES | CNc1cc(C)ccc1C(N)=S |
| InChI | InChI=1S/C9H12N2S/c1-6-3-4-7(9(10)12)8(5-6)11-2/h3-5,11H,1-2H3,(H2,10,12) |
| InChIKey | YNWKNIGAZGAGJL-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|