C16H18N2S2 — CID 62845288
4-methyl-2-(4,5,6,7-tetrahydro-1-benzothiophen-4-ylamino)benzenecarbothioamide (PubChem CID 62845288) has the molecular formula C16H18N2S2 and a molecular weight of 302.47 g/mol. Its IUPAC name is 4-methyl-2-(4,5,6,7-tetrahydro-1-benzothiophen-4-ylamino)benzenecarbothioamide.
| Compound Name | 4-methyl-2-(4,5,6,7-tetrahydro-1-benzothiophen-4-ylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 62845288 |
| Molecular Formula | C16H18N2S2 |
| Molecular Weight | 302.47 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 4-methyl-2-(4,5,6,7-tetrahydro-1-benzothiophen-4-ylamino)benzenecarbothioamide |
| SMILES | Cc1ccc(C(N)=S)c(NC2CCCc3sccc32)c1 |
| InChI | InChI=1S/C16H18N2S2/c1-10-5-6-12(16(17)19)14(9-10)18-13-3-2-4-15-11(13)7-8-20-15/h5-9,13,18H,2-4H2,1H3,(H2,17,19) |
| InChIKey | YZWJQXDKEGNFPD-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.47 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|