C14H17F3N2S — CID 114546656
2-[(3-methylcyclopentyl)amino]-5-(trifluoromethyl)benzenecarbothioamide (PubChem CID 114546656) has the molecular formula C14H17F3N2S and a molecular weight of 302.37 g/mol. Its IUPAC name is 2-[(3-methylcyclopentyl)amino]-5-(trifluoromethyl)benzenecarbothioamide.
| Compound Name | 2-[(3-methylcyclopentyl)amino]-5-(trifluoromethyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 114546656 |
| Molecular Formula | C14H17F3N2S |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 2-[(3-methylcyclopentyl)amino]-5-(trifluoromethyl)benzenecarbothioamide |
| SMILES | CC1CCC(Nc2ccc(C(F)(F)F)cc2C(N)=S)C1 |
| InChI | InChI=1S/C14H17F3N2S/c1-8-2-4-10(6-8)19-12-5-3-9(14(15,16)17)7-11(12)13(18)20/h3,5,7-8,10,19H,2,4,6H2,1H3,(H2,18,20) |
| InChIKey | CLJHIIDODMVFCE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|