C13H19N3O3S — CID 82988556
N,N-dimethyl-3-(3-methylsulfanylpropylamino)-4-nitrobenzamide (PubChem CID 82988556) has the molecular formula C13H19N3O3S and a molecular weight of 297.38 g/mol. Its IUPAC name is N,N-dimethyl-3-(3-methylsulfanylpropylamino)-4-nitrobenzamide.
| Compound Name | N,N-dimethyl-3-(3-methylsulfanylpropylamino)-4-nitrobenzamide |
|---|---|
| PubChem CID | 82988556 |
| Molecular Formula | C13H19N3O3S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | N,N-dimethyl-3-(3-methylsulfanylpropylamino)-4-nitrobenzamide |
| SMILES | CSCCCNc1cc(C(=O)N(C)C)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H19N3O3S/c1-15(2)13(17)10-5-6-12(16(18)19)11(9-10)14-7-4-8-20-3/h5-6,9,14H,4,7-8H2,1-3H3 |
| InChIKey | YAWRQVJNCAIYHH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|