C12H17N3O5 — CID 82988962
3-(1,3-dihydroxypropan-2-ylamino)-N,N-dimethyl-4-nitrobenzamide (PubChem CID 82988962) has the molecular formula C12H17N3O5 and a molecular weight of 283.28 g/mol. Its IUPAC name is 3-(1,3-dihydroxypropan-2-ylamino)-N,N-dimethyl-4-nitrobenzamide.
| Compound Name | 3-(1,3-dihydroxypropan-2-ylamino)-N,N-dimethyl-4-nitrobenzamide |
|---|---|
| PubChem CID | 82988962 |
| Molecular Formula | C12H17N3O5 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 3-(1,3-dihydroxypropan-2-ylamino)-N,N-dimethyl-4-nitrobenzamide |
| SMILES | CN(C)C(=O)c1ccc([N+](=O)[O-])c(NC(CO)CO)c1 |
| InChI | InChI=1S/C12H17N3O5/c1-14(2)12(18)8-3-4-11(15(19)20)10(5-8)13-9(6-16)7-17/h3-5,9,13,16-17H,6-7H2,1-2H3 |
| InChIKey | JZYADDFHYJWEIP-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 115.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|