C19H30N2O3S — CID 42768170
ethyl 2-[[cyclohexanecarbonyl(pentyl)amino]methyl]-1,3-thiazole-4-carboxylate (PubChem CID 42768170) has the molecular formula C19H30N2O3S and a molecular weight of 366.53 g/mol. Its IUPAC name is ethyl 2-[[cyclohexanecarbonyl(pentyl)amino]methyl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[[cyclohexanecarbonyl(pentyl)amino]methyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 42768170 |
| Molecular Formula | C19H30N2O3S |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | ethyl 2-[[cyclohexanecarbonyl(pentyl)amino]methyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCCCCN(Cc1nc(C(=O)OCC)cs1)C(=O)C1CCCCC1 |
| InChI | InChI=1S/C19H30N2O3S/c1-3-5-9-12-21(18(22)15-10-7-6-8-11-15)13-17-20-16(14-25-17)19(23)24-4-2/h14-15H,3-13H2,1-2H3 |
| InChIKey | JXSYEZBUSWPIOJ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|