C16H19FN2O6S — CID 3670767
methyl 2-[[(4-fluorophenyl)sulfonyl-(3-methoxypropyl)amino]methyl]-1,3-oxazole-4-carboxylate (PubChem CID 3670767) has the molecular formula C16H19FN2O6S and a molecular weight of 386.40 g/mol. Its IUPAC name is methyl 2-[[(4-fluorophenyl)sulfonyl-(3-methoxypropyl)amino]methyl]-1,3-oxazole-4-carboxylate.
| Compound Name | methyl 2-[[(4-fluorophenyl)sulfonyl-(3-methoxypropyl)amino]methyl]-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 3670767 |
| Molecular Formula | C16H19FN2O6S |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | methyl 2-[[(4-fluorophenyl)sulfonyl-(3-methoxypropyl)amino]methyl]-1,3-oxazole-4-carboxylate |
| SMILES | COCCCN(Cc1nc(C(=O)OC)co1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H19FN2O6S/c1-23-9-3-8-19(10-15-18-14(11-25-15)16(20)24-2)26(21,22)13-6-4-12(17)5-7-13/h4-7,11H,3,8-10H2,1-2H3 |
| InChIKey | ANUQTGHIMKAOMX-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 98.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|