C17H21FN2O5S2 — CID 3997811
ethyl 2-[[(4-fluorophenyl)sulfonyl-(3-methoxypropyl)amino]methyl]-1,3-thiazole-4-carboxylate (PubChem CID 3997811) has the molecular formula C17H21FN2O5S2 and a molecular weight of 416.50 g/mol. Its IUPAC name is ethyl 2-[[(4-fluorophenyl)sulfonyl-(3-methoxypropyl)amino]methyl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[[(4-fluorophenyl)sulfonyl-(3-methoxypropyl)amino]methyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 3997811 |
| Molecular Formula | C17H21FN2O5S2 |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | ethyl 2-[[(4-fluorophenyl)sulfonyl-(3-methoxypropyl)amino]methyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(CN(CCCOC)S(=O)(=O)c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C17H21FN2O5S2/c1-3-25-17(21)15-12-26-16(19-15)11-20(9-4-10-24-2)27(22,23)14-7-5-13(18)6-8-14/h5-8,12H,3-4,9-11H2,1-2H3 |
| InChIKey | PGEBSKRUFGPQDG-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|