C9H8F2N2O2 — CID 153001758
2-(2-amino-4,5-difluorophenyl)-2-methyliminoacetic acid (PubChem CID 153001758) has the molecular formula C9H8F2N2O2 and a molecular weight of 214.17 g/mol. Its IUPAC name is 2-(2-amino-4,5-difluorophenyl)-2-methyliminoacetic acid.
| Compound Name | 2-(2-amino-4,5-difluorophenyl)-2-methyliminoacetic acid |
|---|---|
| PubChem CID | 153001758 |
| Molecular Formula | C9H8F2N2O2 |
| Molecular Weight | 214.17 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 2-(2-amino-4,5-difluorophenyl)-2-methyliminoacetic acid |
| SMILES | C/N=C(\C(=O)O)c1cc(F)c(F)cc1N |
| InChI | InChI=1S/C9H8F2N2O2/c1-13-8(9(14)15)4-2-5(10)6(11)3-7(4)12/h2-3H,12H2,1H3,(H,14,15)/b13-8- |
| InChIKey | YRAHASOQHZYCJT-JYRVWZFOSA-N |
| XLogP | 1.05 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.17 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|