C13H18F2N2O2 — CID 106180006
2-amino-4,5-difluoro-N-(3-hydroxy-2,3-dimethylbutan-2-yl)benzamide (PubChem CID 106180006) has the molecular formula C13H18F2N2O2 and a molecular weight of 272.30 g/mol. Its IUPAC name is 2-amino-4,5-difluoro-N-(3-hydroxy-2,3-dimethylbutan-2-yl)benzamide.
| Compound Name | 2-amino-4,5-difluoro-N-(3-hydroxy-2,3-dimethylbutan-2-yl)benzamide |
|---|---|
| PubChem CID | 106180006 |
| Molecular Formula | C13H18F2N2O2 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 2-amino-4,5-difluoro-N-(3-hydroxy-2,3-dimethylbutan-2-yl)benzamide |
| SMILES | CC(C)(O)C(C)(C)NC(=O)c1cc(F)c(F)cc1N |
| InChI | InChI=1S/C13H18F2N2O2/c1-12(2,13(3,4)19)17-11(18)7-5-8(14)9(15)6-10(7)16/h5-6,19H,16H2,1-4H3,(H,17,18) |
| InChIKey | REXPSUJFBVTNFZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|