C27H30F4N4O2 — CID 158733354
2-amino-4,5-difluoro-N-(2-methylbut-3-yn-2-yl)benzamide;4,5-difluoro-N-(2-methylbut-3-yn-2-yl)-2-(propan-2-ylamino)benzamide (PubChem CID 158733354) has the molecular formula C27H30F4N4O2 and a molecular weight of 518.56 g/mol. Its IUPAC name is 2-amino-4,5-difluoro-N-(2-methylbut-3-yn-2-yl)benzamide;4,5-difluoro-N-(2-methylbut-3-yn-2-yl)-2-(propan-2-ylamino)benzamide.
| Compound Name | 2-amino-4,5-difluoro-N-(2-methylbut-3-yn-2-yl)benzamide;4,5-difluoro-N-(2-methylbut-3-yn-2-yl)-2-(propan-2-ylamino)benzamide |
|---|---|
| PubChem CID | 158733354 |
| Molecular Formula | C27H30F4N4O2 |
| Molecular Weight | 518.56 g/mol |
| Exact Mass | 518.23 |
| IUPAC Name | 2-amino-4,5-difluoro-N-(2-methylbut-3-yn-2-yl)benzamide;4,5-difluoro-N-(2-methylbut-3-yn-2-yl)-2-(propan-2-ylamino)benzamide |
| SMILES | C#CC(C)(C)NC(=O)c1cc(F)c(F)cc1N.C#CC(C)(C)NC(=O)c1cc(F)c(F)cc1NC(C)C |
| InChI | InChI=1S/C15H18F2N2O.C12H12F2N2O/c1-6-15(4,5)19-14(20)10-7-11(16)12(17)8-13(10)18-9(2)3;1-4-12(2,3)16-11(17)7-5-8(13)9(14)6-10(7)15/h1,7-9,18H,2-5H3,(H,19,20);1,5-6H,15H2,2-3H3,(H,16,17) |
| InChIKey | ILJGNSQJBAVOPL-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.56 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|