C15H24N2O2 — CID 106180016
5-amino-N-(3-hydroxy-2,3-dimethylbutan-2-yl)-2,4-dimethylbenzamide (PubChem CID 106180016) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 5-amino-N-(3-hydroxy-2,3-dimethylbutan-2-yl)-2,4-dimethylbenzamide.
| Compound Name | 5-amino-N-(3-hydroxy-2,3-dimethylbutan-2-yl)-2,4-dimethylbenzamide |
|---|---|
| PubChem CID | 106180016 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 5-amino-N-(3-hydroxy-2,3-dimethylbutan-2-yl)-2,4-dimethylbenzamide |
| SMILES | Cc1cc(C)c(C(=O)NC(C)(C)C(C)(C)O)cc1N |
| InChI | InChI=1S/C15H24N2O2/c1-9-7-10(2)12(16)8-11(9)13(18)17-14(3,4)15(5,6)19/h7-8,19H,16H2,1-6H3,(H,17,18) |
| InChIKey | UUKVMLDOKSNITM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|