C11H12ClF2N3O2 — CID 82772683
N-[(3Z)-3-amino-3-hydroxyimino-2-methylpropyl]-4-chloro-2,5-difluorobenzamide (PubChem CID 82772683) has the molecular formula C11H12ClF2N3O2 and a molecular weight of 291.69 g/mol. Its IUPAC name is N-[(3Z)-3-amino-3-hydroxyimino-2-methylpropyl]-4-chloro-2,5-difluorobenzamide.
| Compound Name | N-[(3Z)-3-amino-3-hydroxyimino-2-methylpropyl]-4-chloro-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 82772683 |
| Molecular Formula | C11H12ClF2N3O2 |
| Molecular Weight | 291.69 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | N-[(3Z)-3-amino-3-hydroxyimino-2-methylpropyl]-4-chloro-2,5-difluorobenzamide |
| SMILES | CC(CNC(=O)c1cc(F)c(Cl)cc1F)/C(N)=N/O |
| InChI | InChI=1S/C11H12ClF2N3O2/c1-5(10(15)17-19)4-16-11(18)6-2-9(14)7(12)3-8(6)13/h2-3,5,19H,4H2,1H3,(H2,15,17)(H,16,18) |
| InChIKey | CAPNOLXVDRACLZ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.69 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|