C13H17BrClNO2S — CID 114171426
N-[3-(2-bromoethoxy)propyl]-2-chloro-5-methylsulfanylbenzamide (PubChem CID 114171426) has the molecular formula C13H17BrClNO2S and a molecular weight of 366.71 g/mol. Its IUPAC name is N-[3-(2-bromoethoxy)propyl]-2-chloro-5-methylsulfanylbenzamide.
| Compound Name | N-[3-(2-bromoethoxy)propyl]-2-chloro-5-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 114171426 |
| Molecular Formula | C13H17BrClNO2S |
| Molecular Weight | 366.71 g/mol |
| Exact Mass | 364.99 |
| IUPAC Name | N-[3-(2-bromoethoxy)propyl]-2-chloro-5-methylsulfanylbenzamide |
| SMILES | CSc1ccc(Cl)c(C(=O)NCCCOCCBr)c1 |
| InChI | InChI=1S/C13H17BrClNO2S/c1-19-10-3-4-12(15)11(9-10)13(17)16-6-2-7-18-8-5-14/h3-4,9H,2,5-8H2,1H3,(H,16,17) |
| InChIKey | BNCFTJKXCDTMMR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.71 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|