C10H7BrF4INO — CID 103528337
2-bromo-5-iodo-N-(2,2,3,3-tetrafluoropropyl)benzamide (PubChem CID 103528337) has the molecular formula C10H7BrF4INO and a molecular weight of 439.97 g/mol. Its IUPAC name is 2-bromo-5-iodo-N-(2,2,3,3-tetrafluoropropyl)benzamide.
| Compound Name | 2-bromo-5-iodo-N-(2,2,3,3-tetrafluoropropyl)benzamide |
|---|---|
| PubChem CID | 103528337 |
| Molecular Formula | C10H7BrF4INO |
| Molecular Weight | 439.97 g/mol |
| Exact Mass | 438.87 |
| IUPAC Name | 2-bromo-5-iodo-N-(2,2,3,3-tetrafluoropropyl)benzamide |
| SMILES | O=C(NCC(F)(F)C(F)F)c1cc(I)ccc1Br |
| InChI | InChI=1S/C10H7BrF4INO/c11-7-2-1-5(16)3-6(7)8(18)17-4-10(14,15)9(12)13/h1-3,9H,4H2,(H,17,18) |
| InChIKey | OFYHXUDLOJTICY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.97 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|