C11H14INO4S — CID 104628255
N-(2-ethylsulfonylethyl)-3-hydroxy-4-iodobenzamide (PubChem CID 104628255) has the molecular formula C11H14INO4S and a molecular weight of 383.21 g/mol. Its IUPAC name is N-(2-ethylsulfonylethyl)-3-hydroxy-4-iodobenzamide.
| Compound Name | N-(2-ethylsulfonylethyl)-3-hydroxy-4-iodobenzamide |
|---|---|
| PubChem CID | 104628255 |
| Molecular Formula | C11H14INO4S |
| Molecular Weight | 383.21 g/mol |
| Exact Mass | 382.97 |
| IUPAC Name | N-(2-ethylsulfonylethyl)-3-hydroxy-4-iodobenzamide |
| SMILES | CCS(=O)(=O)CCNC(=O)c1ccc(I)c(O)c1 |
| InChI | InChI=1S/C11H14INO4S/c1-2-18(16,17)6-5-13-11(15)8-3-4-9(12)10(14)7-8/h3-4,7,14H,2,5-6H2,1H3,(H,13,15) |
| InChIKey | DVTJYSPMFMIPOR-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.21 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|