C13H14ClNO4 — CID 66177068
6-chloro-N-(2,3-dihydroxypropyl)-2H-chromene-3-carboxamide (PubChem CID 66177068) has the molecular formula C13H14ClNO4 and a molecular weight of 283.71 g/mol. Its IUPAC name is 6-chloro-N-(2,3-dihydroxypropyl)-2H-chromene-3-carboxamide.
| Compound Name | 6-chloro-N-(2,3-dihydroxypropyl)-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 66177068 |
| Molecular Formula | C13H14ClNO4 |
| Molecular Weight | 283.71 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 6-chloro-N-(2,3-dihydroxypropyl)-2H-chromene-3-carboxamide |
| SMILES | O=C(NCC(O)CO)C1=Cc2cc(Cl)ccc2OC1 |
| InChI | InChI=1S/C13H14ClNO4/c14-10-1-2-12-8(4-10)3-9(7-19-12)13(18)15-5-11(17)6-16/h1-4,11,16-17H,5-7H2,(H,15,18) |
| InChIKey | BWSJHMMXVKWWJR-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.71 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |