C12H12ClNO3 — CID 60700765
6-chloro-N-ethoxy-2H-chromene-3-carboxamide (PubChem CID 60700765) has the molecular formula C12H12ClNO3 and a molecular weight of 253.68 g/mol. Its IUPAC name is 6-chloro-N-ethoxy-2H-chromene-3-carboxamide.
| Compound Name | 6-chloro-N-ethoxy-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 60700765 |
| Molecular Formula | C12H12ClNO3 |
| Molecular Weight | 253.68 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 6-chloro-N-ethoxy-2H-chromene-3-carboxamide |
| SMILES | CCONC(=O)C1=Cc2cc(Cl)ccc2OC1 |
| InChI | InChI=1S/C12H12ClNO3/c1-2-17-14-12(15)9-5-8-6-10(13)3-4-11(8)16-7-9/h3-6H,2,7H2,1H3,(H,14,15) |
| InChIKey | OMRYOOPORCNBMB-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.68 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|