C16H20ClNO3 — CID 103772938
6-chloro-N-(4-hydroxy-2,2-dimethylbutyl)-2H-chromene-3-carboxamide (PubChem CID 103772938) has the molecular formula C16H20ClNO3 and a molecular weight of 309.79 g/mol. Its IUPAC name is 6-chloro-N-(4-hydroxy-2,2-dimethylbutyl)-2H-chromene-3-carboxamide.
| Compound Name | 6-chloro-N-(4-hydroxy-2,2-dimethylbutyl)-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 103772938 |
| Molecular Formula | C16H20ClNO3 |
| Molecular Weight | 309.79 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 6-chloro-N-(4-hydroxy-2,2-dimethylbutyl)-2H-chromene-3-carboxamide |
| SMILES | CC(C)(CCO)CNC(=O)C1=Cc2cc(Cl)ccc2OC1 |
| InChI | InChI=1S/C16H20ClNO3/c1-16(2,5-6-19)10-18-15(20)12-7-11-8-13(17)3-4-14(11)21-9-12/h3-4,7-8,19H,5-6,9-10H2,1-2H3,(H,18,20) |
| InChIKey | KRBZNULGSNFKKP-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.79 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |