C14H16ClNO4 — CID 61234889
6-chloro-N,N-bis(2-hydroxyethyl)-2H-chromene-3-carboxamide (PubChem CID 61234889) has the molecular formula C14H16ClNO4 and a molecular weight of 297.74 g/mol. Its IUPAC name is 6-chloro-N,N-bis(2-hydroxyethyl)-2H-chromene-3-carboxamide.
| Compound Name | 6-chloro-N,N-bis(2-hydroxyethyl)-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 61234889 |
| Molecular Formula | C14H16ClNO4 |
| Molecular Weight | 297.74 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 6-chloro-N,N-bis(2-hydroxyethyl)-2H-chromene-3-carboxamide |
| SMILES | O=C(C1=Cc2cc(Cl)ccc2OC1)N(CCO)CCO |
| InChI | InChI=1S/C14H16ClNO4/c15-12-1-2-13-10(8-12)7-11(9-20-13)14(19)16(3-5-17)4-6-18/h1-2,7-8,17-18H,3-6,9H2 |
| InChIKey | TWTDIEHKQUVLCW-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.74 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |