C14H14ClNO4 — CID 43242074
3-[(6-chloro-2H-chromene-3-carbonyl)amino]butanoic acid (PubChem CID 43242074) has the molecular formula C14H14ClNO4 and a molecular weight of 295.72 g/mol. Its IUPAC name is 3-[(6-chloro-2H-chromene-3-carbonyl)amino]butanoic acid.
| Compound Name | 3-[(6-chloro-2H-chromene-3-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 43242074 |
| Molecular Formula | C14H14ClNO4 |
| Molecular Weight | 295.72 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 3-[(6-chloro-2H-chromene-3-carbonyl)amino]butanoic acid |
| SMILES | CC(CC(=O)O)NC(=O)C1=Cc2cc(Cl)ccc2OC1 |
| InChI | InChI=1S/C14H14ClNO4/c1-8(4-13(17)18)16-14(19)10-5-9-6-11(15)2-3-12(9)20-7-10/h2-3,5-6,8H,4,7H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | XSDCGTRSRZQGEX-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.72 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |