C20H18Cl2N2O3 — CID 60532279
6-chloro-N-[2-chloro-5-(propan-2-ylcarbamoyl)phenyl]-2H-chromene-3-carboxamide (PubChem CID 60532279) has the molecular formula C20H18Cl2N2O3 and a molecular weight of 405.28 g/mol. Its IUPAC name is 6-chloro-N-[2-chloro-5-(propan-2-ylcarbamoyl)phenyl]-2H-chromene-3-carboxamide.
| Compound Name | 6-chloro-N-[2-chloro-5-(propan-2-ylcarbamoyl)phenyl]-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 60532279 |
| Molecular Formula | C20H18Cl2N2O3 |
| Molecular Weight | 405.28 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | 6-chloro-N-[2-chloro-5-(propan-2-ylcarbamoyl)phenyl]-2H-chromene-3-carboxamide |
| SMILES | CC(C)NC(=O)c1ccc(Cl)c(NC(=O)C2=Cc3cc(Cl)ccc3OC2)c1 |
| InChI | InChI=1S/C20H18Cl2N2O3/c1-11(2)23-19(25)12-3-5-16(22)17(9-12)24-20(26)14-7-13-8-15(21)4-6-18(13)27-10-14/h3-9,11H,10H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | BSCGRIGYFCFUQN-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.28 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |