C16H10ClF2NO2 — CID 24517965
6-chloro-N-(2,5-difluorophenyl)-2H-chromene-3-carboxamide (PubChem CID 24517965) has the molecular formula C16H10ClF2NO2 and a molecular weight of 321.71 g/mol. Its IUPAC name is 6-chloro-N-(2,5-difluorophenyl)-2H-chromene-3-carboxamide.
| Compound Name | 6-chloro-N-(2,5-difluorophenyl)-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 24517965 |
| Molecular Formula | C16H10ClF2NO2 |
| Molecular Weight | 321.71 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 6-chloro-N-(2,5-difluorophenyl)-2H-chromene-3-carboxamide |
| SMILES | O=C(Nc1cc(F)ccc1F)C1=Cc2cc(Cl)ccc2OC1 |
| InChI | InChI=1S/C16H10ClF2NO2/c17-11-1-4-15-9(6-11)5-10(8-22-15)16(21)20-14-7-12(18)2-3-13(14)19/h1-7H,8H2,(H,20,21) |
| InChIKey | PPAPHWCNLKOWAZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.71 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |