C22H24ClN3O2 — CID 55441969
6-chloro-N-[2-(4-ethylpiperazin-1-yl)phenyl]-2H-chromene-3-carboxamide (PubChem CID 55441969) has the molecular formula C22H24ClN3O2 and a molecular weight of 397.91 g/mol. Its IUPAC name is 6-chloro-N-[2-(4-ethylpiperazin-1-yl)phenyl]-2H-chromene-3-carboxamide.
| Compound Name | 6-chloro-N-[2-(4-ethylpiperazin-1-yl)phenyl]-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 55441969 |
| Molecular Formula | C22H24ClN3O2 |
| Molecular Weight | 397.91 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 6-chloro-N-[2-(4-ethylpiperazin-1-yl)phenyl]-2H-chromene-3-carboxamide |
| SMILES | CCN1CCN(c2ccccc2NC(=O)C2=Cc3cc(Cl)ccc3OC2)CC1 |
| InChI | InChI=1S/C22H24ClN3O2/c1-2-25-9-11-26(12-10-25)20-6-4-3-5-19(20)24-22(27)17-13-16-14-18(23)7-8-21(16)28-15-17/h3-8,13-14H,2,9-12,15H2,1H3,(H,24,27) |
| InChIKey | MXBZLLXLPGCLNV-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.91 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |